C19H23N5O2S3 — CID 2803859
1-[[N-(benzenesulfonyl)-C-pyrrolidin-1-ylcarbonimidoyl]amino]-3-(3-methylsulfanylphenyl)thiourea (PubChem CID 2803859) has the molecular formula C19H23N5O2S3 and a molecular weight of 449.63 g/mol. Its IUPAC name is 1-[[N-(benzenesulfonyl)-C-pyrrolidin-1-ylcarbonimidoyl]amino]-3-(3-methylsulfanylphenyl)thiourea.
| Compound Name | 1-[[N-(benzenesulfonyl)-C-pyrrolidin-1-ylcarbonimidoyl]amino]-3-(3-methylsulfanylphenyl)thiourea |
|---|---|
| PubChem CID | 2803859 |
| Molecular Formula | C19H23N5O2S3 |
| Molecular Weight | 449.63 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 1-[[N-(benzenesulfonyl)-C-pyrrolidin-1-ylcarbonimidoyl]amino]-3-(3-methylsulfanylphenyl)thiourea |
| SMILES | CSc1cccc(NC(=S)NNC(=NS(=O)(=O)c2ccccc2)N2CCCC2)c1 |
| InChI | InChI=1S/C19H23N5O2S3/c1-28-16-9-7-8-15(14-16)20-19(27)22-21-18(24-12-5-6-13-24)23-29(25,26)17-10-3-2-4-11-17/h2-4,7-11,14H,5-6,12-13H2,1H3,(H,21,23)(H2,20,22,27) |
| InChIKey | OZDLTDOMQBXKDE-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.63 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|