C21H19F2N7O2S3 — CID 2803774
1-[[N'-(benzenesulfonyl)-N-[(4-fluorophenyl)carbamothioylamino]carbamimidoyl]amino]-3-(4-fluorophenyl)thiourea (PubChem CID 2803774) has the molecular formula C21H19F2N7O2S3 and a molecular weight of 535.63 g/mol. Its IUPAC name is 1-[[N'-(benzenesulfonyl)-N-[(4-fluorophenyl)carbamothioylamino]carbamimidoyl]amino]-3-(4-fluorophenyl)thiourea.
| Compound Name | 1-[[N'-(benzenesulfonyl)-N-[(4-fluorophenyl)carbamothioylamino]carbamimidoyl]amino]-3-(4-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 2803774 |
| Molecular Formula | C21H19F2N7O2S3 |
| Molecular Weight | 535.63 g/mol |
| Exact Mass | 535.07 |
| IUPAC Name | 1-[[N'-(benzenesulfonyl)-N-[(4-fluorophenyl)carbamothioylamino]carbamimidoyl]amino]-3-(4-fluorophenyl)thiourea |
| SMILES | O=S(=O)(N=C(NNC(=S)Nc1ccc(F)cc1)NNC(=S)Nc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H19F2N7O2S3/c22-14-6-10-16(11-7-14)24-20(33)28-26-19(30-35(31,32)18-4-2-1-3-5-18)27-29-21(34)25-17-12-8-15(23)9-13-17/h1-13H,(H2,24,28,33)(H2,25,29,34)(H2,26,27,30) |
| InChIKey | VOISNDGZAHGMGD-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 118.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.63 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|