C14H13ClN2O2S2 — CID 10712227
methyl N'-(benzenesulfonyl)-N-(4-chlorophenyl)carbamimidothioate (PubChem CID 10712227) has the molecular formula C14H13ClN2O2S2 and a molecular weight of 340.86 g/mol. Its IUPAC name is methyl N'-(benzenesulfonyl)-N-(4-chlorophenyl)carbamimidothioate.
| Compound Name | methyl N'-(benzenesulfonyl)-N-(4-chlorophenyl)carbamimidothioate |
|---|---|
| PubChem CID | 10712227 |
| Molecular Formula | C14H13ClN2O2S2 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | methyl N'-(benzenesulfonyl)-N-(4-chlorophenyl)carbamimidothioate |
| SMILES | CS/C(=N\S(=O)(=O)c1ccccc1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H13ClN2O2S2/c1-20-14(16-12-9-7-11(15)8-10-12)17-21(18,19)13-5-3-2-4-6-13/h2-10H,1H3,(H,16,17) |
| InChIKey | OXLCTNNVXSVLDD-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|