C20H24N4O2S3 — CID 133269458
methyl N'-[(3S,4S)-4-[[anilino(methylsulfanyl)methylidene]amino]-1,1-dioxothiolan-3-yl]-N-phenylcarbamimidothioate (PubChem CID 133269458) has the molecular formula C20H24N4O2S3 and a molecular weight of 448.64 g/mol. Its IUPAC name is methyl N'-[(3S,4S)-4-[[anilino(methylsulfanyl)methylidene]amino]-1,1-dioxothiolan-3-yl]-N-phenylcarbamimidothioate.
| Compound Name | methyl N'-[(3S,4S)-4-[[anilino(methylsulfanyl)methylidene]amino]-1,1-dioxothiolan-3-yl]-N-phenylcarbamimidothioate |
|---|---|
| PubChem CID | 133269458 |
| Molecular Formula | C20H24N4O2S3 |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | methyl N'-[(3S,4S)-4-[[anilino(methylsulfanyl)methylidene]amino]-1,1-dioxothiolan-3-yl]-N-phenylcarbamimidothioate |
| SMILES | CS/C(=N\[C@@H]1CS(=O)(=O)C[C@H]1/N=C(/Nc1ccccc1)SC)Nc1ccccc1 |
| InChI | InChI=1S/C20H24N4O2S3/c1-27-19(21-15-9-5-3-6-10-15)23-17-13-29(25,26)14-18(17)24-20(28-2)22-16-11-7-4-8-12-16/h3-12,17-18H,13-14H2,1-2H3,(H,21,23)(H,22,24)/t17-,18-/m1/s1 |
| InChIKey | DBGVISYMTUTPHY-QZTJIDSGSA-N |
| XLogP | 3.81 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|