C16H19N5O5S — CID 54196366
methyl 2-[[[(4,6-dimethylpyrimidin-2-yl)amino]-(methoxyamino)methylidene]amino]sulfonylbenzoate (PubChem CID 54196366) has the molecular formula C16H19N5O5S and a molecular weight of 393.43 g/mol. Its IUPAC name is methyl 2-[[[(4,6-dimethylpyrimidin-2-yl)amino]-(methoxyamino)methylidene]amino]sulfonylbenzoate.
| Compound Name | methyl 2-[[[(4,6-dimethylpyrimidin-2-yl)amino]-(methoxyamino)methylidene]amino]sulfonylbenzoate |
|---|---|
| PubChem CID | 54196366 |
| Molecular Formula | C16H19N5O5S |
| Molecular Weight | 393.43 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | methyl 2-[[[(4,6-dimethylpyrimidin-2-yl)amino]-(methoxyamino)methylidene]amino]sulfonylbenzoate |
| SMILES | CONC(=NS(=O)(=O)c1ccccc1C(=O)OC)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C16H19N5O5S/c1-10-9-11(2)18-15(17-10)19-16(20-26-4)21-27(23,24)13-8-6-5-7-12(13)14(22)25-3/h5-9H,1-4H3,(H2,17,18,19,20,21) |
| InChIKey | PMCBQPUJTLADHP-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 131.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|