C19H17Cl2N5O2S — CID 54189440
2-(2,5-dichlorophenyl)sulfonyl-1-(4,6-dimethylpyrimidin-2-yl)-3-phenylguanidine (PubChem CID 54189440) has the molecular formula C19H17Cl2N5O2S and a molecular weight of 450.35 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfonyl-1-(4,6-dimethylpyrimidin-2-yl)-3-phenylguanidine.
| Compound Name | 2-(2,5-dichlorophenyl)sulfonyl-1-(4,6-dimethylpyrimidin-2-yl)-3-phenylguanidine |
|---|---|
| PubChem CID | 54189440 |
| Molecular Formula | C19H17Cl2N5O2S |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfonyl-1-(4,6-dimethylpyrimidin-2-yl)-3-phenylguanidine |
| SMILES | Cc1cc(C)nc(NC(=NS(=O)(=O)c2cc(Cl)ccc2Cl)Nc2ccccc2)n1 |
| InChI | InChI=1S/C19H17Cl2N5O2S/c1-12-10-13(2)23-18(22-12)25-19(24-15-6-4-3-5-7-15)26-29(27,28)17-11-14(20)8-9-16(17)21/h3-11H,1-2H3,(H2,22,23,24,25,26) |
| InChIKey | PHLPRQOFVCEOJP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|