C12H13ClN4O2S — CID 29301609
5-amino-2-chloro-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide (PubChem CID 29301609) has the molecular formula C12H13ClN4O2S and a molecular weight of 312.78 g/mol. Its IUPAC name is 5-amino-2-chloro-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide.
| Compound Name | 5-amino-2-chloro-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 29301609 |
| Molecular Formula | C12H13ClN4O2S |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 5-amino-2-chloro-N-(4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2cc(N)ccc2Cl)n1 |
| InChI | InChI=1S/C12H13ClN4O2S/c1-7-5-8(2)16-12(15-7)17-20(18,19)11-6-9(14)3-4-10(11)13/h3-6H,14H2,1-2H3,(H,15,16,17) |
| InChIKey | MKVVJEUZUCRECC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|