C14H18N4O2S — CID 43256532
5-amino-N-(4,6-dimethylpyrimidin-2-yl)-2-ethylbenzenesulfonamide (PubChem CID 43256532) has the molecular formula C14H18N4O2S and a molecular weight of 306.39 g/mol. Its IUPAC name is 5-amino-N-(4,6-dimethylpyrimidin-2-yl)-2-ethylbenzenesulfonamide.
| Compound Name | 5-amino-N-(4,6-dimethylpyrimidin-2-yl)-2-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 43256532 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 5-amino-N-(4,6-dimethylpyrimidin-2-yl)-2-ethylbenzenesulfonamide |
| SMILES | CCc1ccc(N)cc1S(=O)(=O)Nc1nc(C)cc(C)n1 |
| InChI | InChI=1S/C14H18N4O2S/c1-4-11-5-6-12(15)8-13(11)21(19,20)18-14-16-9(2)7-10(3)17-14/h5-8H,4,15H2,1-3H3,(H,16,17,18) |
| InChIKey | UWXIMKDHAFZZFQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|