C13H22N2O2S — CID 43255687
5-amino-2-ethyl-N-pentan-3-ylbenzenesulfonamide (PubChem CID 43255687) has the molecular formula C13H22N2O2S and a molecular weight of 270.40 g/mol. Its IUPAC name is 5-amino-2-ethyl-N-pentan-3-ylbenzenesulfonamide.
| Compound Name | 5-amino-2-ethyl-N-pentan-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 43255687 |
| Molecular Formula | C13H22N2O2S |
| Molecular Weight | 270.40 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 5-amino-2-ethyl-N-pentan-3-ylbenzenesulfonamide |
| SMILES | CCc1ccc(N)cc1S(=O)(=O)NC(CC)CC |
| InChI | InChI=1S/C13H22N2O2S/c1-4-10-7-8-11(14)9-13(10)18(16,17)15-12(5-2)6-3/h7-9,12,15H,4-6,14H2,1-3H3 |
| InChIKey | AVLKHTZDXFWTCO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|