C10H14F2N2O2S — CID 113303506
5-amino-N-(2,2-difluoroethyl)-2-ethylbenzenesulfonamide (PubChem CID 113303506) has the molecular formula C10H14F2N2O2S and a molecular weight of 264.30 g/mol. Its IUPAC name is 5-amino-N-(2,2-difluoroethyl)-2-ethylbenzenesulfonamide.
| Compound Name | 5-amino-N-(2,2-difluoroethyl)-2-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 113303506 |
| Molecular Formula | C10H14F2N2O2S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 5-amino-N-(2,2-difluoroethyl)-2-ethylbenzenesulfonamide |
| SMILES | CCc1ccc(N)cc1S(=O)(=O)NCC(F)F |
| InChI | InChI=1S/C10H14F2N2O2S/c1-2-7-3-4-8(13)5-9(7)17(15,16)14-6-10(11)12/h3-5,10,14H,2,6,13H2,1H3 |
| InChIKey | FCPPTQJMAFIAOI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|