C12H14ClN3O2S2 — CID 61471894
5-amino-2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 61471894) has the molecular formula C12H14ClN3O2S2 and a molecular weight of 331.85 g/mol. Its IUPAC name is 5-amino-2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-amino-2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 61471894 |
| Molecular Formula | C12H14ClN3O2S2 |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 5-amino-2-chloro-N-(4-ethyl-5-methyl-1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | CCc1nc(NS(=O)(=O)c2cc(N)ccc2Cl)sc1C |
| InChI | InChI=1S/C12H14ClN3O2S2/c1-3-10-7(2)19-12(15-10)16-20(17,18)11-6-8(14)4-5-9(11)13/h4-6H,3,14H2,1-2H3,(H,15,16) |
| InChIKey | UUTGZXQPBAHFAI-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|