C14H18N6O8S2 — CID 54193697
methyl 2-[[[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]-(methoxyamino)methylidene]amino]sulfonylbenzenesulfonate (PubChem CID 54193697) has the molecular formula C14H18N6O8S2 and a molecular weight of 462.47 g/mol. Its IUPAC name is methyl 2-[[[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]-(methoxyamino)methylidene]amino]sulfonylbenzenesulfonate.
| Compound Name | methyl 2-[[[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]-(methoxyamino)methylidene]amino]sulfonylbenzenesulfonate |
|---|---|
| PubChem CID | 54193697 |
| Molecular Formula | C14H18N6O8S2 |
| Molecular Weight | 462.47 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | methyl 2-[[[(4,6-dimethoxy-1,3,5-triazin-2-yl)amino]-(methoxyamino)methylidene]amino]sulfonylbenzenesulfonate |
| SMILES | CONC(=NS(=O)(=O)c1ccccc1S(=O)(=O)OC)Nc1nc(OC)nc(OC)n1 |
| InChI | InChI=1S/C14H18N6O8S2/c1-25-13-16-11(17-14(18-13)26-2)15-12(19-27-3)20-29(21,22)9-7-5-6-8-10(9)30(23,24)28-4/h5-8H,1-4H3,(H2,15,16,17,18,19,20) |
| InChIKey | PKGVDFMCAARIDF-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 180.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.47 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|