C14H16N6O5S2 — CID 23318522
1-(4,6-dimethoxy-1,3,5-triazin-2-yl)-3-[(2-methyl-3H-1,2-benzothiazol-7-yl)sulfonyl]urea (PubChem CID 23318522) has the molecular formula C14H16N6O5S2 and a molecular weight of 412.45 g/mol. Its IUPAC name is 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)-3-[(2-methyl-3H-1,2-benzothiazol-7-yl)sulfonyl]urea.
| Compound Name | 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)-3-[(2-methyl-3H-1,2-benzothiazol-7-yl)sulfonyl]urea |
|---|---|
| PubChem CID | 23318522 |
| Molecular Formula | C14H16N6O5S2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 1-(4,6-dimethoxy-1,3,5-triazin-2-yl)-3-[(2-methyl-3H-1,2-benzothiazol-7-yl)sulfonyl]urea |
| SMILES | COc1nc(NC(=O)NS(=O)(=O)c2cccc3c2SN(C)C3)nc(OC)n1 |
| InChI | InChI=1S/C14H16N6O5S2/c1-20-7-8-5-4-6-9(10(8)26-20)27(22,23)19-12(21)15-11-16-13(24-2)18-14(17-11)25-3/h4-6H,7H2,1-3H3,(H2,15,16,17,18,19,21) |
| InChIKey | JMYVVRUHVXYFTA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|