C11H15NO5S — CID 94282290
N-[2-(2,5-dimethoxyphenyl)-2-oxoethyl]methanesulfonamide (PubChem CID 94282290) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is N-[2-(2,5-dimethoxyphenyl)-2-oxoethyl]methanesulfonamide.
| Compound Name | N-[2-(2,5-dimethoxyphenyl)-2-oxoethyl]methanesulfonamide |
|---|---|
| PubChem CID | 94282290 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | N-[2-(2,5-dimethoxyphenyl)-2-oxoethyl]methanesulfonamide |
| SMILES | COc1ccc(OC)c(C(=O)CNS(C)(=O)=O)c1 |
| InChI | InChI=1S/C11H15NO5S/c1-16-8-4-5-11(17-2)9(6-8)10(13)7-12-18(3,14)15/h4-6,12H,7H2,1-3H3 |
| InChIKey | CGGWDPWLMDIPIF-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |