C13H17NO3 — CID 82102263
1-(2,5-dimethoxyphenyl)-2-(prop-2-enylamino)ethanone (PubChem CID 82102263) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-(prop-2-enylamino)ethanone.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-(prop-2-enylamino)ethanone |
|---|---|
| PubChem CID | 82102263 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-(prop-2-enylamino)ethanone |
| SMILES | C=CCNCC(=O)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C13H17NO3/c1-4-7-14-9-12(15)11-8-10(16-2)5-6-13(11)17-3/h4-6,8,14H,1,7,9H2,2-3H3 |
| InChIKey | JEQQJTANBDSTDC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|