C15H13F3N6O3 — CID 168604617
1-(diaminomethylidene)-2-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]guanidine (PubChem CID 168604617) has the molecular formula C15H13F3N6O3 and a molecular weight of 382.30 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]guanidine |
|---|---|
| PubChem CID | 168604617 |
| Molecular Formula | C15H13F3N6O3 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 1-(diaminomethylidene)-2-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/c1cc(Oc2cccc(C(F)(F)F)c2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H13F3N6O3/c16-15(17,18)8-2-1-3-11(4-8)27-12-6-9(5-10(7-12)24(25)26)22-14(21)23-13(19)20/h1-7H,(H6,19,20,21,22,23) |
| InChIKey | KPANEGWTWSPKFQ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 155.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|