C16H14ClF3N2O4 — CID 168639544
1-chloro-3-[3-nitro-5-[3-(trifluoromethyl)phenoxy]anilino]propan-2-ol (PubChem CID 168639544) has the molecular formula C16H14ClF3N2O4 and a molecular weight of 390.75 g/mol. Its IUPAC name is 1-chloro-3-[3-nitro-5-[3-(trifluoromethyl)phenoxy]anilino]propan-2-ol.
| Compound Name | 1-chloro-3-[3-nitro-5-[3-(trifluoromethyl)phenoxy]anilino]propan-2-ol |
|---|---|
| PubChem CID | 168639544 |
| Molecular Formula | C16H14ClF3N2O4 |
| Molecular Weight | 390.75 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 1-chloro-3-[3-nitro-5-[3-(trifluoromethyl)phenoxy]anilino]propan-2-ol |
| SMILES | O=[N+]([O-])c1cc(NCC(O)CCl)cc(Oc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H14ClF3N2O4/c17-8-13(23)9-21-11-5-12(22(24)25)7-15(6-11)26-14-3-1-2-10(4-14)16(18,19)20/h1-7,13,21,23H,8-9H2 |
| InChIKey | AOPYSFRNOOVYBW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 84.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.75 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|