C19H14BrF3N4O4 — CID 19267505
4-bromo-1-ethyl-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]pyrazole-3-carboxamide (PubChem CID 19267505) has the molecular formula C19H14BrF3N4O4 and a molecular weight of 499.24 g/mol. Its IUPAC name is 4-bromo-1-ethyl-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]pyrazole-3-carboxamide.
| Compound Name | 4-bromo-1-ethyl-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19267505 |
| Molecular Formula | C19H14BrF3N4O4 |
| Molecular Weight | 499.24 g/mol |
| Exact Mass | 498.02 |
| IUPAC Name | 4-bromo-1-ethyl-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]pyrazole-3-carboxamide |
| SMILES | CCn1cc(Br)c(C(=O)Nc2cc(Oc3cccc(C(F)(F)F)c3)cc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C19H14BrF3N4O4/c1-2-26-10-16(20)17(25-26)18(28)24-12-7-13(27(29)30)9-15(8-12)31-14-5-3-4-11(6-14)19(21,22)23/h3-10H,2H2,1H3,(H,24,28) |
| InChIKey | UOSNTADTAFLIRP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.24 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|