C21H19F3N4O4 — CID 19472249
1-ethyl-3,5-dimethyl-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]pyrazole-4-carboxamide (PubChem CID 19472249) has the molecular formula C21H19F3N4O4 and a molecular weight of 448.40 g/mol. Its IUPAC name is 1-ethyl-3,5-dimethyl-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]pyrazole-4-carboxamide.
| Compound Name | 1-ethyl-3,5-dimethyl-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 19472249 |
| Molecular Formula | C21H19F3N4O4 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 1-ethyl-3,5-dimethyl-N-[3-nitro-5-[3-(trifluoromethyl)phenoxy]phenyl]pyrazole-4-carboxamide |
| SMILES | CCn1nc(C)c(C(=O)Nc2cc(Oc3cccc(C(F)(F)F)c3)cc([N+](=O)[O-])c2)c1C |
| InChI | InChI=1S/C21H19F3N4O4/c1-4-27-13(3)19(12(2)26-27)20(29)25-15-9-16(28(30)31)11-18(10-15)32-17-7-5-6-14(8-17)21(22,23)24/h5-11H,4H2,1-3H3,(H,25,29) |
| InChIKey | SVYZJDONXHTBFF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|