C14H10Cl3N3O3 — CID 169366838
2-chloro-N'-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]ethanimidamide (PubChem CID 169366838) has the molecular formula C14H10Cl3N3O3 and a molecular weight of 374.61 g/mol. Its IUPAC name is 2-chloro-N'-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]ethanimidamide |
|---|---|
| PubChem CID | 169366838 |
| Molecular Formula | C14H10Cl3N3O3 |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 2-chloro-N'-[3-(2,4-dichlorophenoxy)-5-nitrophenyl]ethanimidamide |
| SMILES | N/C(CCl)=N/c1cc(Oc2ccc(Cl)cc2Cl)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H10Cl3N3O3/c15-7-14(18)19-9-4-10(20(21)22)6-11(5-9)23-13-2-1-8(16)3-12(13)17/h1-6H,7H2,(H2,18,19) |
| InChIKey | GTTQNTNEKMJKBF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|