C14H13NO3 — CID 22164458
1,4-dimethyl-2-(4-nitrophenoxy)benzene (PubChem CID 22164458) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is 1,4-dimethyl-2-(4-nitrophenoxy)benzene.
| Compound Name | 1,4-dimethyl-2-(4-nitrophenoxy)benzene |
|---|---|
| PubChem CID | 22164458 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 1,4-dimethyl-2-(4-nitrophenoxy)benzene |
| SMILES | Cc1ccc(C)c(Oc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C14H13NO3/c1-10-3-4-11(2)14(9-10)18-13-7-5-12(6-8-13)15(16)17/h3-9H,1-2H3 |
| InChIKey | ODMGBPWZDRGWPT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|