C14H11Cl2NO3 — CID 2797579
2,4-dichloro-1,3-dimethyl-5-(4-nitrophenoxy)benzene (PubChem CID 2797579) has the molecular formula C14H11Cl2NO3 and a molecular weight of 312.15 g/mol. Its IUPAC name is 2,4-dichloro-1,3-dimethyl-5-(4-nitrophenoxy)benzene.
| Compound Name | 2,4-dichloro-1,3-dimethyl-5-(4-nitrophenoxy)benzene |
|---|---|
| PubChem CID | 2797579 |
| Molecular Formula | C14H11Cl2NO3 |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 2,4-dichloro-1,3-dimethyl-5-(4-nitrophenoxy)benzene |
| SMILES | Cc1cc(Oc2ccc([N+](=O)[O-])cc2)c(Cl)c(C)c1Cl |
| InChI | InChI=1S/C14H11Cl2NO3/c1-8-7-12(14(16)9(2)13(8)15)20-11-5-3-10(4-6-11)17(18)19/h3-7H,1-2H3 |
| InChIKey | HDCLVGDBPIPIEF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|