C8H9BrN6O2 — CID 168601634
2-(3-bromo-2-nitrophenyl)-1-(diaminomethylidene)guanidine (PubChem CID 168601634) has the molecular formula C8H9BrN6O2 and a molecular weight of 301.10 g/mol. Its IUPAC name is 2-(3-bromo-2-nitrophenyl)-1-(diaminomethylidene)guanidine.
| Compound Name | 2-(3-bromo-2-nitrophenyl)-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168601634 |
| Molecular Formula | C8H9BrN6O2 |
| Molecular Weight | 301.10 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 2-(3-bromo-2-nitrophenyl)-1-(diaminomethylidene)guanidine |
| SMILES | NC(N)=N/C(N)=N/c1cccc(Br)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H9BrN6O2/c9-4-2-1-3-5(6(4)15(16)17)13-8(12)14-7(10)11/h1-3H,(H6,10,11,12,13,14) |
| InChIKey | WBAVEGXOJAVMTI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 145.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.10 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|