C9H9BrClN5O2 — CID 168604816
2-[[amino-(diaminomethylideneamino)methylidene]amino]-3-bromo-6-chlorobenzoic acid (PubChem CID 168604816) has the molecular formula C9H9BrClN5O2 and a molecular weight of 334.56 g/mol. Its IUPAC name is 2-[[amino-(diaminomethylideneamino)methylidene]amino]-3-bromo-6-chlorobenzoic acid.
| Compound Name | 2-[[amino-(diaminomethylideneamino)methylidene]amino]-3-bromo-6-chlorobenzoic acid |
|---|---|
| PubChem CID | 168604816 |
| Molecular Formula | C9H9BrClN5O2 |
| Molecular Weight | 334.56 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | 2-[[amino-(diaminomethylideneamino)methylidene]amino]-3-bromo-6-chlorobenzoic acid |
| SMILES | NC(N)=N/C(N)=N\c1c(Br)ccc(Cl)c1C(=O)O |
| InChI | InChI=1S/C9H9BrClN5O2/c10-3-1-2-4(11)5(7(17)18)6(3)15-9(14)16-8(12)13/h1-2H,(H,17,18)(H6,12,13,14,15,16) |
| InChIKey | OTXNNFGBXUCCHC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 140.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.56 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|