C12H17Br2N5 — CID 168601655
1-(diaminomethylidene)-2-(2,6-dibromo-4-butylphenyl)guanidine (PubChem CID 168601655) has the molecular formula C12H17Br2N5 and a molecular weight of 391.11 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-(2,6-dibromo-4-butylphenyl)guanidine.
| Compound Name | 1-(diaminomethylidene)-2-(2,6-dibromo-4-butylphenyl)guanidine |
|---|---|
| PubChem CID | 168601655 |
| Molecular Formula | C12H17Br2N5 |
| Molecular Weight | 391.11 g/mol |
| Exact Mass | 388.99 |
| IUPAC Name | 1-(diaminomethylidene)-2-(2,6-dibromo-4-butylphenyl)guanidine |
| SMILES | CCCCc1cc(Br)c(/N=C(/N)N=C(N)N)c(Br)c1 |
| InChI | InChI=1S/C12H17Br2N5/c1-2-3-4-7-5-8(13)10(9(14)6-7)18-12(17)19-11(15)16/h5-6H,2-4H2,1H3,(H6,15,16,17,18,19) |
| InChIKey | NEHWILUTAIZCKA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 102.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.11 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|