C22H37N3 — CID 172962172
(3E)-3-hydrazinylidene-N-(2,4,6-tributylphenyl)butan-2-imine (PubChem CID 172962172) has the molecular formula C22H37N3 and a molecular weight of 343.56 g/mol. Its IUPAC name is (3E)-3-hydrazinylidene-N-(2,4,6-tributylphenyl)butan-2-imine.
| Compound Name | (3E)-3-hydrazinylidene-N-(2,4,6-tributylphenyl)butan-2-imine |
|---|---|
| PubChem CID | 172962172 |
| Molecular Formula | C22H37N3 |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.30 |
| IUPAC Name | (3E)-3-hydrazinylidene-N-(2,4,6-tributylphenyl)butan-2-imine |
| SMILES | CCCCc1cc(CCCC)c(/N=C(C)/C(C)=N/N)c(CCCC)c1 |
| InChI | InChI=1S/C22H37N3/c1-6-9-12-19-15-20(13-10-7-2)22(21(16-19)14-11-8-3)24-17(4)18(5)25-23/h15-16H,6-14,23H2,1-5H3/b24-17+,25-18+ |
| InChIKey | DZCXGDMHFZCHHM-WZGDJCGDSA-N |
| XLogP | 6.14 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|