C17H22O2 — CID 21033341
7-butyl-5-propylnaphthalene-2,3-diol (PubChem CID 21033341) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 7-butyl-5-propylnaphthalene-2,3-diol.
| Compound Name | 7-butyl-5-propylnaphthalene-2,3-diol |
|---|---|
| PubChem CID | 21033341 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 7-butyl-5-propylnaphthalene-2,3-diol |
| SMILES | CCCCc1cc(CCC)c2cc(O)c(O)cc2c1 |
| InChI | InChI=1S/C17H22O2/c1-3-5-7-12-8-13(6-4-2)15-11-17(19)16(18)10-14(15)9-12/h8-11,18-19H,3-7H2,1-2H3 |
| InChIKey | NDOHPRWBEYEPFJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|