C46H64N2O2 — CID 87911096
5-N,6-N-bis(3,4-diethylphenyl)decane-5,6-diimine;5,7-dipropylnaphthalene-2,3-diol (PubChem CID 87911096) has the molecular formula C46H64N2O2 and a molecular weight of 677.03 g/mol. Its IUPAC name is 5-N,6-N-bis(3,4-diethylphenyl)decane-5,6-diimine;5,7-dipropylnaphthalene-2,3-diol.
| Compound Name | 5-N,6-N-bis(3,4-diethylphenyl)decane-5,6-diimine;5,7-dipropylnaphthalene-2,3-diol |
|---|---|
| PubChem CID | 87911096 |
| Molecular Formula | C46H64N2O2 |
| Molecular Weight | 677.03 g/mol |
| Exact Mass | 676.50 |
| IUPAC Name | 5-N,6-N-bis(3,4-diethylphenyl)decane-5,6-diimine;5,7-dipropylnaphthalene-2,3-diol |
| SMILES | CCCCC(=N\c1ccc(CC)c(CC)c1)/C(CCCC)=N/c1ccc(CC)c(CC)c1.CCCc1cc(CCC)c2cc(O)c(O)cc2c1 |
| InChI | InChI=1S/C30H44N2.C16H20O2/c1-7-13-15-29(31-27-19-17-23(9-3)25(11-5)21-27)30(16-14-8-2)32-28-20-18-24(10-4)26(12-6)22-28;1-3-5-11-7-12(6-4-2)14-10-16(18)15(17)9-13(14)8-11/h17-22H,7-16H2,1-6H3;7-10,17-18H,3-6H2,1-2H3/b31-29+,32-30+; |
| InChIKey | RSODYWHWTICQEW-JPGNHJAOSA-N |
| XLogP | 13.32 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.03 |
| LogP ≤ 5 | 13.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|