About 2-azido-1,3-dibromo-5-butylbenzene
2-azido-1,3-dibromo-5-butylbenzene (PubChem CID 151556371) has the molecular formula C10H11Br2N3
and a molecular weight of 333.03 g/mol. Its IUPAC name is 2-azido-1,3-dibromo-5-butylbenzene.
Molecular Properties
| Compound Name | 2-azido-1,3-dibromo-5-butylbenzene |
| PubChem CID | 151556371 |
| Molecular Formula | C10H11Br2N3 |
| Molecular Weight | 333.03 g/mol |
| Exact Mass | 330.93 |
| IUPAC Name | 2-azido-1,3-dibromo-5-butylbenzene |
| SMILES | CCCCc1cc(Br)c(N=[N+]=[N-])c(Br)c1 |
| InChI | InChI=1S/C10H11Br2N3/c1-2-3-4-7-5-8(11)10(14-15-13)9(12)6-7/h5-6H,2-4H2,1H3 |
| InChIKey | QBOHUMHVJRQRMP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.03 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-azido-1,3-dibromo-5-butylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azido-1,3-dibromo-5-butylbenzene?
The IUPAC name of 2-azido-1,3-dibromo-5-butylbenzene (CID 151556371) is 2-azido-1,3-dibromo-5-butylbenzene.
What is the SMILES notation for 2-azido-1,3-dibromo-5-butylbenzene?
The canonical SMILES for 2-azido-1,3-dibromo-5-butylbenzene is CCCCc1cc(Br)c(N=[N+]=[N-])c(Br)c1.
What is the InChIKey of 2-azido-1,3-dibromo-5-butylbenzene?
The InChIKey is QBOHUMHVJRQRMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11Br2N3/c1-2-3-4-7-5-8(11)10(14-15-13)9(12)6-7/h5-6H,2-4H2,1H3.
What are the key properties of 2-azido-1,3-dibromo-5-butylbenzene?
2-azido-1,3-dibromo-5-butylbenzene has a molecular weight of 333.03 g/mol, XLogP of 5.50, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azido-1,3-dibromo-5-butylbenzene is sourced from PubChem (CID 151556371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).