C8H5Br2ClF2N2 — CID 169365748
2-chloro-N'-(2,4-dibromo-3,6-difluorophenyl)ethanimidamide (PubChem CID 169365748) has the molecular formula C8H5Br2ClF2N2 and a molecular weight of 362.40 g/mol. Its IUPAC name is 2-chloro-N'-(2,4-dibromo-3,6-difluorophenyl)ethanimidamide.
| Compound Name | 2-chloro-N'-(2,4-dibromo-3,6-difluorophenyl)ethanimidamide |
|---|---|
| PubChem CID | 169365748 |
| Molecular Formula | C8H5Br2ClF2N2 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 359.85 |
| IUPAC Name | 2-chloro-N'-(2,4-dibromo-3,6-difluorophenyl)ethanimidamide |
| SMILES | N/C(CCl)=N/c1c(F)cc(Br)c(F)c1Br |
| InChI | InChI=1S/C8H5Br2ClF2N2/c9-3-1-4(12)8(6(10)7(3)13)15-5(14)2-11/h1H,2H2,(H2,14,15) |
| InChIKey | PIPAZDWQURWTQD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|