C8H5BrClF2N3O2 — CID 169369118
N'-(2-bromo-3,4-difluoro-6-nitrophenyl)-2-chloroethanimidamide (PubChem CID 169369118) has the molecular formula C8H5BrClF2N3O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is N'-(2-bromo-3,4-difluoro-6-nitrophenyl)-2-chloroethanimidamide.
| Compound Name | N'-(2-bromo-3,4-difluoro-6-nitrophenyl)-2-chloroethanimidamide |
|---|---|
| PubChem CID | 169369118 |
| Molecular Formula | C8H5BrClF2N3O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 326.92 |
| IUPAC Name | N'-(2-bromo-3,4-difluoro-6-nitrophenyl)-2-chloroethanimidamide |
| SMILES | N/C(CCl)=N/c1c([N+](=O)[O-])cc(F)c(F)c1Br |
| InChI | InChI=1S/C8H5BrClF2N3O2/c9-6-7(12)3(11)1-4(15(16)17)8(6)14-5(13)2-10/h1H,2H2,(H2,13,14) |
| InChIKey | IPQJKWFYLHHNGY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 81.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|