C9H7ClN4O6 — CID 169369450
2-[(1-amino-2-chloroethylidene)amino]-3,5-dinitrobenzoic acid (PubChem CID 169369450) has the molecular formula C9H7ClN4O6 and a molecular weight of 302.63 g/mol. Its IUPAC name is 2-[(1-amino-2-chloroethylidene)amino]-3,5-dinitrobenzoic acid.
| Compound Name | 2-[(1-amino-2-chloroethylidene)amino]-3,5-dinitrobenzoic acid |
|---|---|
| PubChem CID | 169369450 |
| Molecular Formula | C9H7ClN4O6 |
| Molecular Weight | 302.63 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 2-[(1-amino-2-chloroethylidene)amino]-3,5-dinitrobenzoic acid |
| SMILES | N/C(CCl)=N/c1c(C(=O)O)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H7ClN4O6/c10-3-7(11)12-8-5(9(15)16)1-4(13(17)18)2-6(8)14(19)20/h1-2H,3H2,(H2,11,12)(H,15,16) |
| InChIKey | OHCDPGQWIMBRQD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 161.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.63 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|