C9H8Br2ClN3O2 — CID 169367133
2-chloro-N'-(4,6-dibromo-2-methyl-3-nitrophenyl)ethanimidamide (PubChem CID 169367133) has the molecular formula C9H8Br2ClN3O2 and a molecular weight of 385.44 g/mol. Its IUPAC name is 2-chloro-N'-(4,6-dibromo-2-methyl-3-nitrophenyl)ethanimidamide.
| Compound Name | 2-chloro-N'-(4,6-dibromo-2-methyl-3-nitrophenyl)ethanimidamide |
|---|---|
| PubChem CID | 169367133 |
| Molecular Formula | C9H8Br2ClN3O2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 382.87 |
| IUPAC Name | 2-chloro-N'-(4,6-dibromo-2-methyl-3-nitrophenyl)ethanimidamide |
| SMILES | Cc1c(/N=C(/N)CCl)c(Br)cc(Br)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8Br2ClN3O2/c1-4-8(14-7(13)3-12)5(10)2-6(11)9(4)15(16)17/h2H,3H2,1H3,(H2,13,14) |
| InChIKey | SXGQJIWUDBRPBN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 81.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|