C9H8Br3ClN2 — CID 169365470
2-chloro-N'-(2,4,6-tribromo-3-methylphenyl)ethanimidamide (PubChem CID 169365470) has the molecular formula C9H8Br3ClN2 and a molecular weight of 419.34 g/mol. Its IUPAC name is 2-chloro-N'-(2,4,6-tribromo-3-methylphenyl)ethanimidamide.
| Compound Name | 2-chloro-N'-(2,4,6-tribromo-3-methylphenyl)ethanimidamide |
|---|---|
| PubChem CID | 169365470 |
| Molecular Formula | C9H8Br3ClN2 |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 415.79 |
| IUPAC Name | 2-chloro-N'-(2,4,6-tribromo-3-methylphenyl)ethanimidamide |
| SMILES | Cc1c(Br)cc(Br)c(/N=C(/N)CCl)c1Br |
| InChI | InChI=1S/C9H8Br3ClN2/c1-4-5(10)2-6(11)9(8(4)12)15-7(14)3-13/h2H,3H2,1H3,(H2,14,15) |
| InChIKey | KLBOKUGLBQOUQF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|