C11H9ClN4 — CID 169369151
2-chloro-N'-(2,4-dicyano-6-methylphenyl)ethanimidamide (PubChem CID 169369151) has the molecular formula C11H9ClN4 and a molecular weight of 232.67 g/mol. Its IUPAC name is 2-chloro-N'-(2,4-dicyano-6-methylphenyl)ethanimidamide.
| Compound Name | 2-chloro-N'-(2,4-dicyano-6-methylphenyl)ethanimidamide |
|---|---|
| PubChem CID | 169369151 |
| Molecular Formula | C11H9ClN4 |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 2-chloro-N'-(2,4-dicyano-6-methylphenyl)ethanimidamide |
| SMILES | Cc1cc(C#N)cc(C#N)c1/N=C(/N)CCl |
| InChI | InChI=1S/C11H9ClN4/c1-7-2-8(5-13)3-9(6-14)11(7)16-10(15)4-12/h2-3H,4H2,1H3,(H2,15,16) |
| InChIKey | NRSVNWISQXHIGS-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 85.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|