C9H6Cl3N3 — CID 169369477
2-chloro-N'-(2,6-dichloro-4-cyanophenyl)ethanimidamide (PubChem CID 169369477) has the molecular formula C9H6Cl3N3 and a molecular weight of 262.53 g/mol. Its IUPAC name is 2-chloro-N'-(2,6-dichloro-4-cyanophenyl)ethanimidamide.
| Compound Name | 2-chloro-N'-(2,6-dichloro-4-cyanophenyl)ethanimidamide |
|---|---|
| PubChem CID | 169369477 |
| Molecular Formula | C9H6Cl3N3 |
| Molecular Weight | 262.53 g/mol |
| Exact Mass | 260.96 |
| IUPAC Name | 2-chloro-N'-(2,6-dichloro-4-cyanophenyl)ethanimidamide |
| SMILES | N#Cc1cc(Cl)c(/N=C(/N)CCl)c(Cl)c1 |
| InChI | InChI=1S/C9H6Cl3N3/c10-3-8(14)15-9-6(11)1-5(4-13)2-7(9)12/h1-2H,3H2,(H2,14,15) |
| InChIKey | UQIRHJRXNPAGKG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|