C10H12BrClN2 — CID 169369458
N'-(4-bromo-2,6-dimethylphenyl)-2-chloroethanimidamide (PubChem CID 169369458) has the molecular formula C10H12BrClN2 and a molecular weight of 275.58 g/mol. Its IUPAC name is N'-(4-bromo-2,6-dimethylphenyl)-2-chloroethanimidamide.
| Compound Name | N'-(4-bromo-2,6-dimethylphenyl)-2-chloroethanimidamide |
|---|---|
| PubChem CID | 169369458 |
| Molecular Formula | C10H12BrClN2 |
| Molecular Weight | 275.58 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | N'-(4-bromo-2,6-dimethylphenyl)-2-chloroethanimidamide |
| SMILES | Cc1cc(Br)cc(C)c1/N=C(/N)CCl |
| InChI | InChI=1S/C10H12BrClN2/c1-6-3-8(11)4-7(2)10(6)14-9(13)5-12/h3-4H,5H2,1-2H3,(H2,13,14) |
| InChIKey | SMSHMQZWCQHCMF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.58 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|