C8H8Cl3N3O2S — CID 169369481
2-chloro-N'-(2,6-dichloro-4-sulfamoylphenyl)ethanimidamide (PubChem CID 169369481) has the molecular formula C8H8Cl3N3O2S and a molecular weight of 316.60 g/mol. Its IUPAC name is 2-chloro-N'-(2,6-dichloro-4-sulfamoylphenyl)ethanimidamide.
| Compound Name | 2-chloro-N'-(2,6-dichloro-4-sulfamoylphenyl)ethanimidamide |
|---|---|
| PubChem CID | 169369481 |
| Molecular Formula | C8H8Cl3N3O2S |
| Molecular Weight | 316.60 g/mol |
| Exact Mass | 314.94 |
| IUPAC Name | 2-chloro-N'-(2,6-dichloro-4-sulfamoylphenyl)ethanimidamide |
| SMILES | N/C(CCl)=N/c1c(Cl)cc(S(N)(=O)=O)cc1Cl |
| InChI | InChI=1S/C8H8Cl3N3O2S/c9-3-7(12)14-8-5(10)1-4(2-6(8)11)17(13,15)16/h1-2H,3H2,(H2,12,14)(H2,13,15,16) |
| InChIKey | CGADPWWLIGFBFY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.60 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|