C9H9Cl2N7O2S — CID 169365306
2-chloro-N'-[5-chloro-4-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]ethanimidamide (PubChem CID 169365306) has the molecular formula C9H9Cl2N7O2S and a molecular weight of 350.19 g/mol. Its IUPAC name is 2-chloro-N'-[5-chloro-4-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[5-chloro-4-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]ethanimidamide |
|---|---|
| PubChem CID | 169365306 |
| Molecular Formula | C9H9Cl2N7O2S |
| Molecular Weight | 350.19 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 2-chloro-N'-[5-chloro-4-sulfamoyl-2-(2H-tetrazol-5-yl)phenyl]ethanimidamide |
| SMILES | N/C(CCl)=N/c1cc(Cl)c(S(N)(=O)=O)cc1-c1nn[nH]n1 |
| InChI | InChI=1S/C9H9Cl2N7O2S/c10-3-8(12)14-6-2-5(11)7(21(13,19)20)1-4(6)9-15-17-18-16-9/h1-2H,3H2,(H2,12,14)(H2,13,19,20)(H,15,16,17,18) |
| InChIKey | HBMDNHLAMWOZPH-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 153.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.19 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|