C11H8ClN11O2S — CID 169342507
2-chloro-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-(2H-tetrazol-5-yl)benzenesulfonamide (PubChem CID 169342507) has the molecular formula C11H8ClN11O2S and a molecular weight of 393.78 g/mol. Its IUPAC name is 2-chloro-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-(2H-tetrazol-5-yl)benzenesulfonamide.
| Compound Name | 2-chloro-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-(2H-tetrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 169342507 |
| Molecular Formula | C11H8ClN11O2S |
| Molecular Weight | 393.78 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 2-chloro-4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-5-(2H-tetrazol-5-yl)benzenesulfonamide |
| SMILES | N#CC(=CNc1cc(Cl)c(S(N)(=O)=O)cc1-c1nn[nH]n1)c1nn[nH]n1 |
| InChI | InChI=1S/C11H8ClN11O2S/c12-7-2-8(15-4-5(3-13)10-16-20-21-17-10)6(11-18-22-23-19-11)1-9(7)26(14,24)25/h1-2,4,15H,(H2,14,24,25)(H,16,17,20,21)(H,18,19,22,23) |
| InChIKey | OFUNOBCQPCBEDU-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 204.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.78 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|