C10H6ClFN6O — CID 169345427
3-(4-chloro-5-fluoro-2-hydroxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169345427) has the molecular formula C10H6ClFN6O and a molecular weight of 280.65 g/mol. Its IUPAC name is 3-(4-chloro-5-fluoro-2-hydroxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-(4-chloro-5-fluoro-2-hydroxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169345427 |
| Molecular Formula | C10H6ClFN6O |
| Molecular Weight | 280.65 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 3-(4-chloro-5-fluoro-2-hydroxyanilino)-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1cc(F)c(Cl)cc1O)c1nn[nH]n1 |
| InChI | InChI=1S/C10H6ClFN6O/c11-6-1-9(19)8(2-7(6)12)14-4-5(3-13)10-15-17-18-16-10/h1-2,4,14,19H,(H,15,16,17,18) |
| InChIKey | GYEOXZLSXLIYOE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.65 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|