C11H6ClF3N6O — CID 169346308
3-[2-chloro-6-hydroxy-4-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169346308) has the molecular formula C11H6ClF3N6O and a molecular weight of 330.66 g/mol. Its IUPAC name is 3-[2-chloro-6-hydroxy-4-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[2-chloro-6-hydroxy-4-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169346308 |
| Molecular Formula | C11H6ClF3N6O |
| Molecular Weight | 330.66 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 3-[2-chloro-6-hydroxy-4-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1c(O)cc(C(F)(F)F)cc1Cl)c1nn[nH]n1 |
| InChI | InChI=1S/C11H6ClF3N6O/c12-7-1-6(11(13,14)15)2-8(22)9(7)17-4-5(3-16)10-18-20-21-19-10/h1-2,4,17,22H,(H,18,19,20,21) |
| InChIKey | KEPPOJJVUVADGB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.66 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|