C11H4ClF5N6 — CID 169343402
3-[6-chloro-2,3-difluoro-4-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile (PubChem CID 169343402) has the molecular formula C11H4ClF5N6 and a molecular weight of 350.64 g/mol. Its IUPAC name is 3-[6-chloro-2,3-difluoro-4-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile.
| Compound Name | 3-[6-chloro-2,3-difluoro-4-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 169343402 |
| Molecular Formula | C11H4ClF5N6 |
| Molecular Weight | 350.64 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 3-[6-chloro-2,3-difluoro-4-(trifluoromethyl)anilino]-2-(2H-tetrazol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=CNc1c(Cl)cc(C(F)(F)F)c(F)c1F)c1nn[nH]n1 |
| InChI | InChI=1S/C11H4ClF5N6/c12-6-1-5(11(15,16)17)7(13)8(14)9(6)19-3-4(2-18)10-20-22-23-21-10/h1,3,19H,(H,20,21,22,23) |
| InChIKey | GYXXCQPCGPMPQG-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 90.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.64 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|