C11H5FIN7 — CID 169344950
4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-fluoro-5-iodobenzonitrile (PubChem CID 169344950) has the molecular formula C11H5FIN7 and a molecular weight of 381.11 g/mol. Its IUPAC name is 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-fluoro-5-iodobenzonitrile.
| Compound Name | 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-fluoro-5-iodobenzonitrile |
|---|---|
| PubChem CID | 169344950 |
| Molecular Formula | C11H5FIN7 |
| Molecular Weight | 381.11 g/mol |
| Exact Mass | 380.96 |
| IUPAC Name | 4-[[2-cyano-2-(2H-tetrazol-5-yl)ethenyl]amino]-2-fluoro-5-iodobenzonitrile |
| SMILES | N#CC(=CNc1cc(F)c(C#N)cc1I)c1nn[nH]n1 |
| InChI | InChI=1S/C11H5FIN7/c12-8-2-10(9(13)1-6(8)3-14)16-5-7(4-15)11-17-19-20-18-11/h1-2,5,16H,(H,17,18,19,20) |
| InChIKey | XSIHTVUNNFRFOJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 114.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.11 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|