C8H9Cl2N3O2S — CID 169366374
2-chloro-N'-(4-chloro-2-sulfamoylphenyl)ethanimidamide (PubChem CID 169366374) has the molecular formula C8H9Cl2N3O2S and a molecular weight of 282.15 g/mol. Its IUPAC name is 2-chloro-N'-(4-chloro-2-sulfamoylphenyl)ethanimidamide.
| Compound Name | 2-chloro-N'-(4-chloro-2-sulfamoylphenyl)ethanimidamide |
|---|---|
| PubChem CID | 169366374 |
| Molecular Formula | C8H9Cl2N3O2S |
| Molecular Weight | 282.15 g/mol |
| Exact Mass | 280.98 |
| IUPAC Name | 2-chloro-N'-(4-chloro-2-sulfamoylphenyl)ethanimidamide |
| SMILES | N/C(CCl)=N/c1ccc(Cl)cc1S(N)(=O)=O |
| InChI | InChI=1S/C8H9Cl2N3O2S/c9-4-8(11)13-6-2-1-5(10)3-7(6)16(12,14)15/h1-3H,4H2,(H2,11,13)(H2,12,14,15) |
| InChIKey | AZCPZJYSJJHGBB-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.15 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|