C13H16ClN3O2 — CID 169369665
2-chloro-N'-(2-cyano-4,5-diethoxyphenyl)ethanimidamide (PubChem CID 169369665) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 2-chloro-N'-(2-cyano-4,5-diethoxyphenyl)ethanimidamide.
| Compound Name | 2-chloro-N'-(2-cyano-4,5-diethoxyphenyl)ethanimidamide |
|---|---|
| PubChem CID | 169369665 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-chloro-N'-(2-cyano-4,5-diethoxyphenyl)ethanimidamide |
| SMILES | CCOc1cc(C#N)c(/N=C(/N)CCl)cc1OCC |
| InChI | InChI=1S/C13H16ClN3O2/c1-3-18-11-5-9(8-15)10(17-13(16)7-14)6-12(11)19-4-2/h5-6H,3-4,7H2,1-2H3,(H2,16,17) |
| InChIKey | LJGLEIIKWNBDOV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 80.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|