C11H13ClF2N2O2 — CID 169367630
2-chloro-N'-[4-(difluoromethoxy)-3-ethoxyphenyl]ethanimidamide (PubChem CID 169367630) has the molecular formula C11H13ClF2N2O2 and a molecular weight of 278.69 g/mol. Its IUPAC name is 2-chloro-N'-[4-(difluoromethoxy)-3-ethoxyphenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[4-(difluoromethoxy)-3-ethoxyphenyl]ethanimidamide |
|---|---|
| PubChem CID | 169367630 |
| Molecular Formula | C11H13ClF2N2O2 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-chloro-N'-[4-(difluoromethoxy)-3-ethoxyphenyl]ethanimidamide |
| SMILES | CCOc1cc(/N=C(/N)CCl)ccc1OC(F)F |
| InChI | InChI=1S/C11H13ClF2N2O2/c1-2-17-9-5-7(16-10(15)6-12)3-4-8(9)18-11(13)14/h3-5,11H,2,6H2,1H3,(H2,15,16) |
| InChIKey | JIZJHAFAQLGRPU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|