C11H13ClF2N2O2 — CID 169368208
2-chloro-N'-[4-(2,2-difluoroethoxy)-3-methoxyphenyl]ethanimidamide (PubChem CID 169368208) has the molecular formula C11H13ClF2N2O2 and a molecular weight of 278.69 g/mol. Its IUPAC name is 2-chloro-N'-[4-(2,2-difluoroethoxy)-3-methoxyphenyl]ethanimidamide.
| Compound Name | 2-chloro-N'-[4-(2,2-difluoroethoxy)-3-methoxyphenyl]ethanimidamide |
|---|---|
| PubChem CID | 169368208 |
| Molecular Formula | C11H13ClF2N2O2 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 2-chloro-N'-[4-(2,2-difluoroethoxy)-3-methoxyphenyl]ethanimidamide |
| SMILES | COc1cc(/N=C(/N)CCl)ccc1OCC(F)F |
| InChI | InChI=1S/C11H13ClF2N2O2/c1-17-9-4-7(16-11(15)5-12)2-3-8(9)18-6-10(13)14/h2-4,10H,5-6H2,1H3,(H2,15,16) |
| InChIKey | RMNMDGZQCGTFIZ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|