C11H15F2N4O2+ — CID 11935921
(Z)-(diaminomethylideneamino)-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]azanium (PubChem CID 11935921) has the molecular formula C11H15F2N4O2+ and a molecular weight of 273.26 g/mol. Its IUPAC name is (Z)-(diaminomethylideneamino)-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]azanium.
| Compound Name | (Z)-(diaminomethylideneamino)-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]azanium |
|---|---|
| PubChem CID | 11935921 |
| Molecular Formula | C11H15F2N4O2+ |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (Z)-(diaminomethylideneamino)-[[4-(difluoromethoxy)-3-ethoxyphenyl]methylidene]azanium |
| SMILES | CCOc1cc(/C=[NH+]\N=C(N)N)ccc1OC(F)F |
| InChI | InChI=1S/C11H14F2N4O2/c1-2-18-9-5-7(6-16-17-11(14)15)3-4-8(9)19-10(12)13/h3-6,10H,2H2,1H3,(H4,14,15,17)/p+1/b16-6- |
| InChIKey | RWXOLDHSQDKTSO-SOFYXZRVSA-O |
| XLogP | -0.63 |
| TPSA | 96.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|