C15H19BrF2O2 — CID 79323633
4-[2-(bromomethyl)-3-methylbut-1-enyl]-1-(difluoromethoxy)-2-ethoxybenzene (PubChem CID 79323633) has the molecular formula C15H19BrF2O2 and a molecular weight of 349.22 g/mol. Its IUPAC name is 4-[2-(bromomethyl)-3-methylbut-1-enyl]-1-(difluoromethoxy)-2-ethoxybenzene.
| Compound Name | 4-[2-(bromomethyl)-3-methylbut-1-enyl]-1-(difluoromethoxy)-2-ethoxybenzene |
|---|---|
| PubChem CID | 79323633 |
| Molecular Formula | C15H19BrF2O2 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 4-[2-(bromomethyl)-3-methylbut-1-enyl]-1-(difluoromethoxy)-2-ethoxybenzene |
| SMILES | CCOc1cc(C=C(CBr)C(C)C)ccc1OC(F)F |
| InChI | InChI=1S/C15H19BrF2O2/c1-4-19-14-8-11(7-12(9-16)10(2)3)5-6-13(14)20-15(17)18/h5-8,10,15H,4,9H2,1-3H3 |
| InChIKey | PTEDIQVLCGYCNV-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|